C12H11NO8S2 — CID 141037759
1-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 141037759) has the molecular formula C12H11NO8S2 and a molecular weight of 361.35 g/mol. Its IUPAC name is 1-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 1-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 141037759 |
| Molecular Formula | C12H11NO8S2 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 1-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CC(=O)Nc1c(S(=O)(=O)O)ccc2c(O)cc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C12H11NO8S2/c1-6(14)13-12-9-4-7(22(16,17)18)5-10(15)8(9)2-3-11(12)23(19,20)21/h2-5,15H,1H3,(H,13,14)(H,16,17,18)(H,19,20,21) |
| InChIKey | JYJHWODLRPSEJV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|