C8H9ClN2O4S — CID 23374009
5-acetamido-2-amino-4-chlorobenzenesulfonic acid (PubChem CID 23374009) has the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. Its IUPAC name is 5-acetamido-2-amino-4-chlorobenzenesulfonic acid.
| Compound Name | 5-acetamido-2-amino-4-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 23374009 |
| Molecular Formula | C8H9ClN2O4S |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 5-acetamido-2-amino-4-chlorobenzenesulfonic acid |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)O)c(N)cc1Cl |
| InChI | InChI=1S/C8H9ClN2O4S/c1-4(12)11-7-3-8(16(13,14)15)6(10)2-5(7)9/h2-3H,10H2,1H3,(H,11,12)(H,13,14,15) |
| InChIKey | UVFONTOGTDXKBD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|