C6H7BN2O6S2 — CID 18729046
CID 18729046 (PubChem CID 18729046) has the molecular formula C6H7BN2O6S2 and a molecular weight of 278.08 g/mol.
| Compound Name | CID 18729046 |
|---|---|
| PubChem CID | 18729046 |
| Molecular Formula | C6H7BN2O6S2 |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | — |
| SMILES | [B]Nc1cc(S(=O)(=O)O)c(N)cc1S(=O)(=O)O |
| InChI | InChI=1S/C6H7BN2O6S2/c7-9-4-2-5(16(10,11)12)3(8)1-6(4)17(13,14)15/h1-2,9H,8H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | KEBDZSMARIDBDS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|