C13H11N3O9S2 — CID 23336095
2-amino-5-[(4-nitrobenzoyl)amino]benzene-1,4-disulfonic acid (PubChem CID 23336095) has the molecular formula C13H11N3O9S2 and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-amino-5-[(4-nitrobenzoyl)amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-amino-5-[(4-nitrobenzoyl)amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 23336095 |
| Molecular Formula | C13H11N3O9S2 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 2-amino-5-[(4-nitrobenzoyl)amino]benzene-1,4-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)c(NC(=O)c2ccc([N+](=O)[O-])cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C13H11N3O9S2/c14-9-5-12(27(23,24)25)10(6-11(9)26(20,21)22)15-13(17)7-1-3-8(4-2-7)16(18)19/h1-6H,14H2,(H,15,17)(H,20,21,22)(H,23,24,25) |
| InChIKey | UDVUXXZHSPUHJC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 207.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|