C17H12N2O7S — CID 23348315
6-hydroxy-3-[(4-nitrobenzoyl)amino]naphthalene-2-sulfonic acid (PubChem CID 23348315) has the molecular formula C17H12N2O7S and a molecular weight of 388.36 g/mol. Its IUPAC name is 6-hydroxy-3-[(4-nitrobenzoyl)amino]naphthalene-2-sulfonic acid.
| Compound Name | 6-hydroxy-3-[(4-nitrobenzoyl)amino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 23348315 |
| Molecular Formula | C17H12N2O7S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 6-hydroxy-3-[(4-nitrobenzoyl)amino]naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1cc2cc(O)ccc2cc1S(=O)(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N2O7S/c20-14-6-3-11-9-16(27(24,25)26)15(8-12(11)7-14)18-17(21)10-1-4-13(5-2-10)19(22)23/h1-9,20H,(H,18,21)(H,24,25,26) |
| InChIKey | ZUFVNPSLNGIMSU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|