C13H10ClN3O9S2 — CID 21425904
2-amino-5-[(4-chloro-3-nitrobenzoyl)amino]benzene-1,4-disulfonic acid (PubChem CID 21425904) has the molecular formula C13H10ClN3O9S2 and a molecular weight of 451.82 g/mol. Its IUPAC name is 2-amino-5-[(4-chloro-3-nitrobenzoyl)amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-amino-5-[(4-chloro-3-nitrobenzoyl)amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 21425904 |
| Molecular Formula | C13H10ClN3O9S2 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 450.95 |
| IUPAC Name | 2-amino-5-[(4-chloro-3-nitrobenzoyl)amino]benzene-1,4-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)c(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C13H10ClN3O9S2/c14-7-2-1-6(3-10(7)17(19)20)13(18)16-9-5-11(27(21,22)23)8(15)4-12(9)28(24,25)26/h1-5H,15H2,(H,16,18)(H,21,22,23)(H,24,25,26) |
| InChIKey | CFPZKSHOXZZQBV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 207.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|