C13H15NO7S2 — CID 163746802
2-amino-5-methoxybenzene-1,4-disulfonic acid;benzene (PubChem CID 163746802) has the molecular formula C13H15NO7S2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-amino-5-methoxybenzene-1,4-disulfonic acid;benzene.
| Compound Name | 2-amino-5-methoxybenzene-1,4-disulfonic acid;benzene |
|---|---|
| PubChem CID | 163746802 |
| Molecular Formula | C13H15NO7S2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-amino-5-methoxybenzene-1,4-disulfonic acid;benzene |
| SMILES | COc1cc(S(=O)(=O)O)c(N)cc1S(=O)(=O)O.c1ccccc1 |
| InChI | InChI=1S/C7H9NO7S2.C6H6/c1-15-5-3-6(16(9,10)11)4(8)2-7(5)17(12,13)14;1-2-4-6-5-3-1/h2-3H,8H2,1H3,(H,9,10,11)(H,12,13,14);1-6H |
| InChIKey | LMOOGDQSWJCQRK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|