C12H12N2O7S2 — CID 172553417
2-amino-5-(4-aminophenoxy)benzene-1,4-disulfonic acid (PubChem CID 172553417) has the molecular formula C12H12N2O7S2 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-amino-5-(4-aminophenoxy)benzene-1,4-disulfonic acid.
| Compound Name | 2-amino-5-(4-aminophenoxy)benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 172553417 |
| Molecular Formula | C12H12N2O7S2 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-amino-5-(4-aminophenoxy)benzene-1,4-disulfonic acid |
| SMILES | Nc1ccc(Oc2cc(S(=O)(=O)O)c(N)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H12N2O7S2/c13-7-1-3-8(4-2-7)21-10-6-11(22(15,16)17)9(14)5-12(10)23(18,19)20/h1-6H,13-14H2,(H,15,16,17)(H,18,19,20) |
| InChIKey | ZSPWJPGTYFFJLO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|