C12H10O8S2 — CID 58782437
5-hydroxy-2-(4-sulfophenoxy)benzenesulfonic acid (PubChem CID 58782437) has the molecular formula C12H10O8S2 and a molecular weight of 346.34 g/mol. Its IUPAC name is 5-hydroxy-2-(4-sulfophenoxy)benzenesulfonic acid.
| Compound Name | 5-hydroxy-2-(4-sulfophenoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 58782437 |
| Molecular Formula | C12H10O8S2 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 5-hydroxy-2-(4-sulfophenoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Oc2ccc(O)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H10O8S2/c13-8-1-6-11(12(7-8)22(17,18)19)20-9-2-4-10(5-3-9)21(14,15)16/h1-7,13H,(H,14,15,16)(H,17,18,19) |
| InChIKey | LMOPHXLDWGRRPU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|