C32H34O11S3 — CID 144898568
2-tert-butyl-5-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid (PubChem CID 144898568) has the molecular formula C32H34O11S3 and a molecular weight of 690.81 g/mol. Its IUPAC name is 2-tert-butyl-5-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid.
| Compound Name | 2-tert-butyl-5-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 144898568 |
| Molecular Formula | C32H34O11S3 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | 2-tert-butyl-5-[4-[4-[4-[(2-methylpropan-2-yl)oxy]phenoxy]phenoxy]-3-sulfophenyl]sulfonylbenzenesulfonic acid |
| SMILES | CC(C)(C)Oc1ccc(Oc2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(C)C)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H34O11S3/c1-31(2,3)27-17-15-25(19-29(27)45(35,36)37)44(33,34)26-16-18-28(30(20-26)46(38,39)40)42-23-9-7-21(8-10-23)41-22-11-13-24(14-12-22)43-32(4,5)6/h7-20H,1-6H3,(H,35,36,37)(H,38,39,40) |
| InChIKey | PQSBHOKRIYKCHK-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 170.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|