C39H42F6O10S3 — CID 89365720
5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid (PubChem CID 89365720) has the molecular formula C39H42F6O10S3 and a molecular weight of 880.94 g/mol. Its IUPAC name is 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid.
| Compound Name | 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89365720 |
| Molecular Formula | C39H42F6O10S3 |
| Molecular Weight | 880.94 g/mol |
| Exact Mass | 880.18 |
| IUPAC Name | 5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]-3-sulfophenyl]sulfonyl-2-(3-methylpentan-3-yl)benzenesulfonic acid |
| SMILES | CCC(C)(CC)Oc1ccc(C(c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(CC)CC)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H42F6O10S3/c1-7-35(5,8-2)31-21-19-29(23-33(31)57(48,49)50)56(46,47)30-20-22-32(34(24-30)58(51,52)53)54-27-15-11-25(12-16-27)37(38(40,41)42,39(43,44)45)26-13-17-28(18-14-26)55-36(6,9-3)10-4/h11-24H,7-10H2,1-6H3,(H,48,49,50)(H,51,52,53) |
| InChIKey | RZQKUXPQGCKIOR-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.94 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|