C35H34F6O10S3 — CID 88960516
5-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)-3-sulfophenyl]propan-2-yl]-2-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]benzenesulfonic acid (PubChem CID 88960516) has the molecular formula C35H34F6O10S3 and a molecular weight of 824.84 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)-3-sulfophenyl]propan-2-yl]-2-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]benzenesulfonic acid.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)-3-sulfophenyl]propan-2-yl]-2-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 88960516 |
| Molecular Formula | C35H34F6O10S3 |
| Molecular Weight | 824.84 g/mol |
| Exact Mass | 824.12 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)-3-sulfophenyl]propan-2-yl]-2-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]benzenesulfonic acid |
| SMILES | CCC(C)(C)Oc1ccc(C(c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)C)cc4)cc3)c(S(=O)(=O)O)c2)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C35H34F6O10S3/c1-6-32(4,5)51-29-18-10-24(20-31(29)54(47,48)49)33(34(36,37)38,35(39,40)41)23-9-17-28(30(19-23)53(44,45)46)50-25-11-15-27(16-12-25)52(42,43)26-13-7-22(8-14-26)21(2)3/h7-21H,6H2,1-5H3,(H,44,45,46)(H,47,48,49) |
| InChIKey | WNEYGPGELPCQHY-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.84 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|