C33H38O4S — CID 71153664
1-(2-methylbutan-2-yloxy)-4-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene (PubChem CID 71153664) has the molecular formula C33H38O4S and a molecular weight of 530.73 g/mol. Its IUPAC name is 1-(2-methylbutan-2-yloxy)-4-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene.
| Compound Name | 1-(2-methylbutan-2-yloxy)-4-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene |
|---|---|
| PubChem CID | 71153664 |
| Molecular Formula | C33H38O4S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1-(2-methylbutan-2-yloxy)-4-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene |
| SMILES | CCC(C)(C)Oc1ccc(Oc2ccc(S(=O)(=O)c3ccc(C(C)(CC)CC)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C33H38O4S/c1-7-32(4,5)37-31-23-22-30(28-12-10-11-13-29(28)31)36-25-16-20-27(21-17-25)38(34,35)26-18-14-24(15-19-26)33(6,8-2)9-3/h10-23H,7-9H2,1-6H3 |
| InChIKey | VVQPQSXTYAQTEN-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |