C34H40O4S — CID 71204952
2-(2-methylpentan-2-yloxy)-6-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene (PubChem CID 71204952) has the molecular formula C34H40O4S and a molecular weight of 544.76 g/mol. Its IUPAC name is 2-(2-methylpentan-2-yloxy)-6-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene.
| Compound Name | 2-(2-methylpentan-2-yloxy)-6-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene |
|---|---|
| PubChem CID | 71204952 |
| Molecular Formula | C34H40O4S |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 2-(2-methylpentan-2-yloxy)-6-[4-[4-(3-methylpentan-3-yl)phenyl]sulfonylphenoxy]naphthalene |
| SMILES | CCCC(C)(C)Oc1ccc2cc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(CC)CC)cc4)cc3)ccc2c1 |
| InChI | InChI=1S/C34H40O4S/c1-7-22-33(4,5)38-30-15-11-25-23-29(14-10-26(25)24-30)37-28-16-20-32(21-17-28)39(35,36)31-18-12-27(13-19-31)34(6,8-2)9-3/h10-21,23-24H,7-9,22H2,1-6H3 |
| InChIKey | XGCVQGMIQYYCNX-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |