C42H38Cl2O6S2 — CID 70667610
2-[4-[4-(2-chlorobutan-2-yl)phenyl]sulfonylphenoxy]-6-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]naphthalene (PubChem CID 70667610) has the molecular formula C42H38Cl2O6S2 and a molecular weight of 773.80 g/mol. Its IUPAC name is 2-[4-[4-(2-chlorobutan-2-yl)phenyl]sulfonylphenoxy]-6-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]naphthalene.
| Compound Name | 2-[4-[4-(2-chlorobutan-2-yl)phenyl]sulfonylphenoxy]-6-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]naphthalene |
|---|---|
| PubChem CID | 70667610 |
| Molecular Formula | C42H38Cl2O6S2 |
| Molecular Weight | 773.80 g/mol |
| Exact Mass | 772.15 |
| IUPAC Name | 2-[4-[4-(2-chlorobutan-2-yl)phenyl]sulfonylphenoxy]-6-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]naphthalene |
| SMILES | CCC(C)(Cl)c1ccc(S(=O)(=O)c2ccc(Oc3ccc4cc(OC(C)(CC)c5ccc(S(=O)(=O)c6ccc(Cl)cc6)cc5)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C42H38Cl2O6S2/c1-5-41(3,44)31-9-19-37(20-10-31)52(47,48)40-25-17-34(18-26-40)49-35-15-7-30-28-36(16-8-29(30)27-35)50-42(4,6-2)32-11-21-38(22-12-32)51(45,46)39-23-13-33(43)14-24-39/h7-28H,5-6H2,1-4H3 |
| InChIKey | RKTGWBLRWKEVRB-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.80 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|