C47H42F6O6S2 — CID 88979766
1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]butan-2-yl]phenyl]sulfonyl-4-methylbenzene (PubChem CID 88979766) has the molecular formula C47H42F6O6S2 and a molecular weight of 880.97 g/mol. Its IUPAC name is 1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]butan-2-yl]phenyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]butan-2-yl]phenyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 88979766 |
| Molecular Formula | C47H42F6O6S2 |
| Molecular Weight | 880.97 g/mol |
| Exact Mass | 880.23 |
| IUPAC Name | 1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-propan-2-ylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]butan-2-yl]phenyl]sulfonyl-4-methylbenzene |
| SMILES | CCC(C)(Oc1ccc(C(c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)C)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1)c1ccc(S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C47H42F6O6S2/c1-6-44(5,34-15-27-42(28-16-34)60(54,55)40-23-7-32(4)8-24-40)59-39-19-13-36(14-20-39)45(46(48,49)50,47(51,52)53)35-11-17-37(18-12-35)58-38-21-29-43(30-22-38)61(56,57)41-25-9-33(10-26-41)31(2)3/h7-31H,6H2,1-5H3 |
| InChIKey | DHGNMSBKZGOABT-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.97 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |