C41H30F6O6S2 — CID 59165224
1-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene (PubChem CID 59165224) has the molecular formula C41H30F6O6S2 and a molecular weight of 796.81 g/mol. Its IUPAC name is 1-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 59165224 |
| Molecular Formula | C41H30F6O6S2 |
| Molecular Weight | 796.81 g/mol |
| Exact Mass | 796.14 |
| IUPAC Name | 1-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(c4ccc(Oc5ccc(S(=O)(=O)c6ccc(C)cc6)cc5)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H30F6O6S2/c1-27-3-19-35(20-4-27)54(48,49)37-23-15-33(16-24-37)52-31-11-7-29(8-12-31)39(40(42,43)44,41(45,46)47)30-9-13-32(14-10-30)53-34-17-25-38(26-18-34)55(50,51)36-21-5-28(2)6-22-36/h3-26H,1-2H3 |
| InChIKey | ZUJNWTNRXNNPJH-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.81 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |