C59H48Cl2O4 — CID 66810064
[4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]butan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone (PubChem CID 66810064) has the molecular formula C59H48Cl2O4 and a molecular weight of 891.93 g/mol. Its IUPAC name is [4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]butan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone.
| Compound Name | [4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]butan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 66810064 |
| Molecular Formula | C59H48Cl2O4 |
| Molecular Weight | 891.93 g/mol |
| Exact Mass | 890.29 |
| IUPAC Name | [4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]butan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone |
| SMILES | CCC(C)(Cl)c1ccc(C(=O)c2ccc(Oc3ccc(C4(c5ccc(OC(C)(CC)c6ccc(C(=O)c7ccc(Cl)cc7)cc6)cc5)c5ccccc5-c5ccccc54)cc3)cc2)cc1 |
| InChI | InChI=1S/C59H48Cl2O4/c1-5-57(3,61)43-23-15-39(16-24-43)56(63)42-21-33-48(34-22-42)64-49-35-27-45(28-36-49)59(53-13-9-7-11-51(53)52-12-8-10-14-54(52)59)46-29-37-50(38-30-46)65-58(4,6-2)44-25-17-40(18-26-44)55(62)41-19-31-47(60)32-20-41/h7-38H,5-6H2,1-4H3 |
| InChIKey | AXLSAWIXTZIBJL-UHFFFAOYSA-N |
| XLogP | 15.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.93 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|