C58H46Cl2O4 — CID 70667608
[4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]propan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone (PubChem CID 70667608) has the molecular formula C58H46Cl2O4 and a molecular weight of 877.91 g/mol. Its IUPAC name is [4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]propan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone.
| Compound Name | [4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]propan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 70667608 |
| Molecular Formula | C58H46Cl2O4 |
| Molecular Weight | 877.91 g/mol |
| Exact Mass | 876.28 |
| IUPAC Name | [4-[4-[9-[4-[2-[4-(4-chlorobenzoyl)phenyl]propan-2-yloxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-[4-(2-chlorobutan-2-yl)phenyl]methanone |
| SMILES | CCC(C)(Cl)c1ccc(C(=O)c2ccc(Oc3ccc(C4(c5ccc(OC(C)(C)c6ccc(C(=O)c7ccc(Cl)cc7)cc6)cc5)c5ccccc5-c5ccccc54)cc3)cc2)cc1 |
| InChI | InChI=1S/C58H46Cl2O4/c1-5-57(4,60)43-24-16-39(17-25-43)55(62)41-20-32-47(33-21-41)63-48-34-26-44(27-35-48)58(52-12-8-6-10-50(52)51-11-7-9-13-53(51)58)45-28-36-49(37-29-45)64-56(2,3)42-22-14-38(15-23-42)54(61)40-18-30-46(59)31-19-40/h6-37H,5H2,1-4H3 |
| InChIKey | BCBOAMJFCTVIPJ-UHFFFAOYSA-N |
| XLogP | 15.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.91 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|