C47H44N2O2 — CID 3404404
4-tert-butyl-N-[4-[9-[4-[(4-tert-butylbenzoyl)amino]phenyl]fluoren-9-yl]phenyl]benzamide (PubChem CID 3404404) has the molecular formula C47H44N2O2 and a molecular weight of 668.88 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[9-[4-[(4-tert-butylbenzoyl)amino]phenyl]fluoren-9-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[9-[4-[(4-tert-butylbenzoyl)amino]phenyl]fluoren-9-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 3404404 |
| Molecular Formula | C47H44N2O2 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | 4-tert-butyl-N-[4-[9-[4-[(4-tert-butylbenzoyl)amino]phenyl]fluoren-9-yl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C3(c4ccc(NC(=O)c5ccc(C(C)(C)C)cc5)cc4)c4ccccc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C47H44N2O2/c1-45(2,3)33-19-15-31(16-20-33)43(50)48-37-27-23-35(24-28-37)47(41-13-9-7-11-39(41)40-12-8-10-14-42(40)47)36-25-29-38(30-26-36)49-44(51)32-17-21-34(22-18-32)46(4,5)6/h7-30H,1-6H3,(H,48,50)(H,49,51) |
| InChIKey | KBDQRDUBHGVUNC-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |