C49H38F6N2O6 — CID 134501830
5-[2-[4-carboxy-3-(2,2-dimethylpropanoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[[4-[9-[4-(methylamino)phenyl]fluoren-9-yl]phenyl]carbamoyl]benzoic acid (PubChem CID 134501830) has the molecular formula C49H38F6N2O6 and a molecular weight of 864.84 g/mol. Its IUPAC name is 5-[2-[4-carboxy-3-(2,2-dimethylpropanoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[[4-[9-[4-(methylamino)phenyl]fluoren-9-yl]phenyl]carbamoyl]benzoic acid.
| Compound Name | 5-[2-[4-carboxy-3-(2,2-dimethylpropanoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[[4-[9-[4-(methylamino)phenyl]fluoren-9-yl]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 134501830 |
| Molecular Formula | C49H38F6N2O6 |
| Molecular Weight | 864.84 g/mol |
| Exact Mass | 864.26 |
| IUPAC Name | 5-[2-[4-carboxy-3-(2,2-dimethylpropanoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[[4-[9-[4-(methylamino)phenyl]fluoren-9-yl]phenyl]carbamoyl]benzoic acid |
| SMILES | CNc1ccc(C2(c3ccc(NC(=O)c4ccc(C(c5ccc(C(=O)O)c(C(=O)C(C)(C)C)c5)(C(F)(F)F)C(F)(F)F)cc4C(=O)O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C49H38F6N2O6/c1-45(2,3)41(58)37-25-29(18-24-36(37)43(60)61)47(48(50,51)52,49(53,54)55)30-17-23-35(38(26-30)44(62)63)42(59)57-32-21-15-28(16-22-32)46(27-13-19-31(56-4)20-14-27)39-11-7-5-9-33(39)34-10-6-8-12-40(34)46/h5-26,56H,1-4H3,(H,57,59)(H,60,61)(H,62,63) |
| InChIKey | WFTSTMBUYCHEMX-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.84 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |