C42H34O3 — CID 142193506
[4-[4-[9-[4-[(2-methylpropan-2-yl)oxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-phenylmethanone (PubChem CID 142193506) has the molecular formula C42H34O3 and a molecular weight of 586.73 g/mol. Its IUPAC name is [4-[4-[9-[4-[(2-methylpropan-2-yl)oxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-phenylmethanone.
| Compound Name | [4-[4-[9-[4-[(2-methylpropan-2-yl)oxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 142193506 |
| Molecular Formula | C42H34O3 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | [4-[4-[9-[4-[(2-methylpropan-2-yl)oxy]phenyl]fluoren-9-yl]phenoxy]phenyl]-phenylmethanone |
| SMILES | CC(C)(C)Oc1ccc(C2(c3ccc(Oc4ccc(C(=O)c5ccccc5)cc4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C42H34O3/c1-41(2,3)45-35-27-21-32(22-28-35)42(38-15-9-7-13-36(38)37-14-8-10-16-39(37)42)31-19-25-34(26-20-31)44-33-23-17-30(18-24-33)40(43)29-11-5-4-6-12-29/h4-28H,1-3H3 |
| InChIKey | NWHINHYFGOPPEN-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |