C41H36Cl2O6S2 — CID 70868153
2-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]-6-[4-[4-(2-chloropropan-2-yl)phenyl]sulfonylphenoxy]naphthalene (PubChem CID 70868153) has the molecular formula C41H36Cl2O6S2 and a molecular weight of 759.77 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]-6-[4-[4-(2-chloropropan-2-yl)phenyl]sulfonylphenoxy]naphthalene.
| Compound Name | 2-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]-6-[4-[4-(2-chloropropan-2-yl)phenyl]sulfonylphenoxy]naphthalene |
|---|---|
| PubChem CID | 70868153 |
| Molecular Formula | C41H36Cl2O6S2 |
| Molecular Weight | 759.77 g/mol |
| Exact Mass | 758.13 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)sulfonylphenyl]butan-2-yloxy]-6-[4-[4-(2-chloropropan-2-yl)phenyl]sulfonylphenoxy]naphthalene |
| SMILES | CCC(C)(Oc1ccc2cc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(C)Cl)cc4)cc3)ccc2c1)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C41H36Cl2O6S2/c1-5-41(4,31-10-20-37(21-11-31)50(44,45)38-22-12-32(42)13-23-38)49-35-15-7-28-26-34(14-6-29(28)27-35)48-33-16-24-39(25-17-33)51(46,47)36-18-8-30(9-19-36)40(2,3)43/h6-27H,5H2,1-4H3 |
| InChIKey | YNTFJMVOKZPMDB-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.77 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|