C68H54O8S2 — CID 142421469
2-[4-[4-[4-[4-[4-(4-anthracen-2-yloxyphenyl)sulfonylphenoxy]phenyl]phenoxy]phenyl]sulfonylphenoxy]anthracene;ethane (PubChem CID 142421469) has the molecular formula C68H54O8S2 and a molecular weight of 1063.31 g/mol. Its IUPAC name is 2-[4-[4-[4-[4-[4-(4-anthracen-2-yloxyphenyl)sulfonylphenoxy]phenyl]phenoxy]phenyl]sulfonylphenoxy]anthracene;ethane.
| Compound Name | 2-[4-[4-[4-[4-[4-(4-anthracen-2-yloxyphenyl)sulfonylphenoxy]phenyl]phenoxy]phenyl]sulfonylphenoxy]anthracene;ethane |
|---|---|
| PubChem CID | 142421469 |
| Molecular Formula | C68H54O8S2 |
| Molecular Weight | 1063.31 g/mol |
| Exact Mass | 1062.33 |
| IUPAC Name | 2-[4-[4-[4-[4-[4-(4-anthracen-2-yloxyphenyl)sulfonylphenoxy]phenyl]phenoxy]phenyl]sulfonylphenoxy]anthracene;ethane |
| SMILES | CC.CC.O=S(=O)(c1ccc(Oc2ccc(-c3ccc(Oc4ccc(S(=O)(=O)c5ccc(Oc6ccc7cc8ccccc8cc7c6)cc5)cc4)cc3)cc2)cc1)c1ccc(Oc2ccc3cc4ccccc4cc3c2)cc1 |
| InChI | InChI=1S/C64H42O8S2.2C2H6/c65-73(66,63-33-25-57(26-34-63)71-59-19-13-49-37-45-5-1-3-7-47(45)39-51(49)41-59)61-29-21-55(22-30-61)69-53-15-9-43(10-16-53)44-11-17-54(18-12-44)70-56-23-31-62(32-24-56)74(67,68)64-35-27-58(28-36-64)72-60-20-14-50-38-46-6-2-4-8-48(46)40-52(50)42-60;2*1-2/h1-42H;2*1-2H3 |
| InChIKey | WTEXHHVVGQTSDX-UHFFFAOYSA-N |
| XLogP | 18.85 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.31 |
| LogP ≤ 5 | 18.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|