C26H22O11S4 — CID 22336466
[4-[4-[3-(4-methylsulfonyloxyphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl] methanesulfonate (PubChem CID 22336466) has the molecular formula C26H22O11S4 and a molecular weight of 638.72 g/mol. Its IUPAC name is [4-[4-[3-(4-methylsulfonyloxyphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl] methanesulfonate.
| Compound Name | [4-[4-[3-(4-methylsulfonyloxyphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl] methanesulfonate |
|---|---|
| PubChem CID | 22336466 |
| Molecular Formula | C26H22O11S4 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.00 |
| IUPAC Name | [4-[4-[3-(4-methylsulfonyloxyphenyl)sulfonylphenoxy]phenyl]sulfonylphenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(S(=O)(=O)c2ccc(Oc3cccc(S(=O)(=O)c4ccc(OS(C)(=O)=O)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C26H22O11S4/c1-38(27,28)36-20-8-14-24(15-9-20)40(31,32)23-12-6-19(7-13-23)35-22-4-3-5-26(18-22)41(33,34)25-16-10-21(11-17-25)37-39(2,29)30/h3-18H,1-2H3 |
| InChIKey | STDXMEMUICKKLI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|