C23H32O2 — CID 71177718
2-ethyl-2-methyl-1-[6-(2-methylpentan-2-yloxy)naphthalen-2-yl]butan-1-one (PubChem CID 71177718) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-ethyl-2-methyl-1-[6-(2-methylpentan-2-yloxy)naphthalen-2-yl]butan-1-one.
| Compound Name | 2-ethyl-2-methyl-1-[6-(2-methylpentan-2-yloxy)naphthalen-2-yl]butan-1-one |
|---|---|
| PubChem CID | 71177718 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-ethyl-2-methyl-1-[6-(2-methylpentan-2-yloxy)naphthalen-2-yl]butan-1-one |
| SMILES | CCCC(C)(C)Oc1ccc2cc(C(=O)C(C)(CC)CC)ccc2c1 |
| InChI | InChI=1S/C23H32O2/c1-7-14-22(4,5)25-20-13-12-17-15-19(11-10-18(17)16-20)21(24)23(6,8-2)9-3/h10-13,15-16H,7-9,14H2,1-6H3 |
| InChIKey | MWSBSWLNPVWYDN-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |