C37H48O4 — CID 134201488
[4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2-ethyl-2-methylbutanoyl)benzoate (PubChem CID 134201488) has the molecular formula C37H48O4 and a molecular weight of 556.79 g/mol. Its IUPAC name is [4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2-ethyl-2-methylbutanoyl)benzoate.
| Compound Name | [4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2-ethyl-2-methylbutanoyl)benzoate |
|---|---|
| PubChem CID | 134201488 |
| Molecular Formula | C37H48O4 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | [4-[2-[4-(2-methylpentan-2-yloxy)phenyl]pentan-2-yl]phenyl] 3-(2-ethyl-2-methylbutanoyl)benzoate |
| SMILES | CCCC(C)(C)Oc1ccc(C(C)(CCC)c2ccc(OC(=O)c3cccc(C(=O)C(C)(CC)CC)c3)cc2)cc1 |
| InChI | InChI=1S/C37H48O4/c1-9-24-35(5,6)41-32-22-18-30(19-23-32)37(8,25-10-2)29-16-20-31(21-17-29)40-34(39)28-15-13-14-27(26-28)33(38)36(7,11-3)12-4/h13-23,26H,9-12,24-25H2,1-8H3 |
| InChIKey | PJOPLFFQWDBIQJ-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|