C31H36O3 — CID 89026714
[4-[1-[4-(2-methylpentan-2-yloxy)phenyl]cyclohexyl]phenyl] benzoate (PubChem CID 89026714) has the molecular formula C31H36O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is [4-[1-[4-(2-methylpentan-2-yloxy)phenyl]cyclohexyl]phenyl] benzoate.
| Compound Name | [4-[1-[4-(2-methylpentan-2-yloxy)phenyl]cyclohexyl]phenyl] benzoate |
|---|---|
| PubChem CID | 89026714 |
| Molecular Formula | C31H36O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | [4-[1-[4-(2-methylpentan-2-yloxy)phenyl]cyclohexyl]phenyl] benzoate |
| SMILES | CCCC(C)(C)Oc1ccc(C2(c3ccc(OC(=O)c4ccccc4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C31H36O3/c1-4-21-30(2,3)34-28-19-15-26(16-20-28)31(22-9-6-10-23-31)25-13-17-27(18-14-25)33-29(32)24-11-7-5-8-12-24/h5,7-8,11-20H,4,6,9-10,21-23H2,1-3H3 |
| InChIKey | HBPZZOZBACSZSY-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|