C36H43IO5 — CID 89467822
1-O-[4-[1-[4-(1-iodo-2-methylpropan-2-yl)oxyphenyl]cyclohexyl]phenyl] 4-O-(2-methylpentan-2-yl) benzene-1,4-dicarboxylate (PubChem CID 89467822) has the molecular formula C36H43IO5 and a molecular weight of 682.64 g/mol. Its IUPAC name is 1-O-[4-[1-[4-(1-iodo-2-methylpropan-2-yl)oxyphenyl]cyclohexyl]phenyl] 4-O-(2-methylpentan-2-yl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-[1-[4-(1-iodo-2-methylpropan-2-yl)oxyphenyl]cyclohexyl]phenyl] 4-O-(2-methylpentan-2-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89467822 |
| Molecular Formula | C36H43IO5 |
| Molecular Weight | 682.64 g/mol |
| Exact Mass | 682.22 |
| IUPAC Name | 1-O-[4-[1-[4-(1-iodo-2-methylpropan-2-yl)oxyphenyl]cyclohexyl]phenyl] 4-O-(2-methylpentan-2-yl) benzene-1,4-dicarboxylate |
| SMILES | CCCC(C)(C)OC(=O)c1ccc(C(=O)Oc2ccc(C3(c4ccc(OC(C)(C)CI)cc4)CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C36H43IO5/c1-6-22-34(2,3)42-33(39)27-12-10-26(11-13-27)32(38)40-30-18-14-28(15-19-30)36(23-8-7-9-24-36)29-16-20-31(21-17-29)41-35(4,5)25-37/h10-21H,6-9,22-25H2,1-5H3 |
| InChIKey | QZYWIKWPQGDJNJ-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.64 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|