C30H42O3 — CID 89391826
[4-[1-[4-(3-methylpentan-3-yloxy)phenyl]cyclohexyl]phenyl] 2,2-dimethylbutanoate (PubChem CID 89391826) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is [4-[1-[4-(3-methylpentan-3-yloxy)phenyl]cyclohexyl]phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[1-[4-(3-methylpentan-3-yloxy)phenyl]cyclohexyl]phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89391826 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | [4-[1-[4-(3-methylpentan-3-yloxy)phenyl]cyclohexyl]phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(CC)Oc1ccc(C2(c3ccc(OC(=O)C(C)(C)CC)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C30H42O3/c1-7-28(4,5)27(31)32-25-17-13-23(14-18-25)30(21-11-10-12-22-30)24-15-19-26(20-16-24)33-29(6,8-2)9-3/h13-20H,7-12,21-22H2,1-6H3 |
| InChIKey | ONZSVSYYGJZVQM-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|