C18H26O3 — CID 118052021
[4-(1-hydroxycyclohexyl)phenyl] 2,2-dimethylbutanoate (PubChem CID 118052021) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is [4-(1-hydroxycyclohexyl)phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-(1-hydroxycyclohexyl)phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118052021 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [4-(1-hydroxycyclohexyl)phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C2(O)CCCCC2)cc1 |
| InChI | InChI=1S/C18H26O3/c1-4-17(2,3)16(19)21-15-10-8-14(9-11-15)18(20)12-6-5-7-13-18/h8-11,20H,4-7,12-13H2,1-3H3 |
| InChIKey | UMRKSLJAYVEOCM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|