C18H25FO3 — CID 164747813
[4-fluoro-3-(1-methylcyclopentyl)oxyphenyl] 2,2-dimethylbutanoate (PubChem CID 164747813) has the molecular formula C18H25FO3 and a molecular weight of 308.39 g/mol. Its IUPAC name is [4-fluoro-3-(1-methylcyclopentyl)oxyphenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-fluoro-3-(1-methylcyclopentyl)oxyphenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 164747813 |
| Molecular Formula | C18H25FO3 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [4-fluoro-3-(1-methylcyclopentyl)oxyphenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(F)c(OC2(C)CCCC2)c1 |
| InChI | InChI=1S/C18H25FO3/c1-5-17(2,3)16(20)21-13-8-9-14(19)15(12-13)22-18(4)10-6-7-11-18/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | CYMNUQYYYQEFIN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|