C18H24O6 — CID 20793483
[3,4-bis(ethenoxymethoxy)phenyl] 2,2-dimethylbutanoate (PubChem CID 20793483) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is [3,4-bis(ethenoxymethoxy)phenyl] 2,2-dimethylbutanoate.
| Compound Name | [3,4-bis(ethenoxymethoxy)phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20793483 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [3,4-bis(ethenoxymethoxy)phenyl] 2,2-dimethylbutanoate |
| SMILES | C=COCOc1ccc(OC(=O)C(C)(C)CC)cc1OCOC=C |
| InChI | InChI=1S/C18H24O6/c1-6-18(4,5)17(19)24-14-9-10-15(22-12-20-7-2)16(11-14)23-13-21-8-3/h7-11H,2-3,6,12-13H2,1,4-5H3 |
| InChIKey | BNCIWOZUWMBXON-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|