C27H23F3O8 — CID 21036115
[4-[[4-(ethenoxymethoxy)phenoxy]methoxy]-3-(trifluoromethyl)phenyl] 4-(ethenoxymethoxy)benzoate (PubChem CID 21036115) has the molecular formula C27H23F3O8 and a molecular weight of 532.47 g/mol. Its IUPAC name is [4-[[4-(ethenoxymethoxy)phenoxy]methoxy]-3-(trifluoromethyl)phenyl] 4-(ethenoxymethoxy)benzoate.
| Compound Name | [4-[[4-(ethenoxymethoxy)phenoxy]methoxy]-3-(trifluoromethyl)phenyl] 4-(ethenoxymethoxy)benzoate |
|---|---|
| PubChem CID | 21036115 |
| Molecular Formula | C27H23F3O8 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | [4-[[4-(ethenoxymethoxy)phenoxy]methoxy]-3-(trifluoromethyl)phenyl] 4-(ethenoxymethoxy)benzoate |
| SMILES | C=COCOc1ccc(OCOc2ccc(OC(=O)c3ccc(OCOC=C)cc3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23F3O8/c1-3-32-16-34-20-7-5-19(6-8-20)26(31)38-23-13-14-25(24(15-23)27(28,29)30)37-18-36-22-11-9-21(10-12-22)35-17-33-4-2/h3-15H,1-2,16-18H2 |
| InChIKey | IMBNYXVMTOYCQV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|