C39H48O8 — CID 59227673
[4-[4-(6-ethenoxyhexoxy)benzoyl]oxy-3-propylphenyl] 4-(6-ethenoxyhexoxy)benzoate (PubChem CID 59227673) has the molecular formula C39H48O8 and a molecular weight of 644.81 g/mol. Its IUPAC name is [4-[4-(6-ethenoxyhexoxy)benzoyl]oxy-3-propylphenyl] 4-(6-ethenoxyhexoxy)benzoate.
| Compound Name | [4-[4-(6-ethenoxyhexoxy)benzoyl]oxy-3-propylphenyl] 4-(6-ethenoxyhexoxy)benzoate |
|---|---|
| PubChem CID | 59227673 |
| Molecular Formula | C39H48O8 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | [4-[4-(6-ethenoxyhexoxy)benzoyl]oxy-3-propylphenyl] 4-(6-ethenoxyhexoxy)benzoate |
| SMILES | C=COCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCOC=C)cc3)c(CCC)c2)cc1 |
| InChI | InChI=1S/C39H48O8/c1-4-15-33-30-36(46-38(40)31-16-20-34(21-17-31)44-28-13-9-7-11-26-42-5-2)24-25-37(33)47-39(41)32-18-22-35(23-19-32)45-29-14-10-8-12-27-43-6-3/h5-6,16-25,30H,2-4,7-15,26-29H2,1H3 |
| InChIKey | RMHPQHDKJUTLBX-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|