C40H40O9 — CID 59629928
[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-2-propylphenyl] 6-(2-methylprop-2-enoyloxy)naphthalene-2-carboxylate (PubChem CID 59629928) has the molecular formula C40H40O9 and a molecular weight of 664.75 g/mol. Its IUPAC name is [4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-2-propylphenyl] 6-(2-methylprop-2-enoyloxy)naphthalene-2-carboxylate.
| Compound Name | [4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-2-propylphenyl] 6-(2-methylprop-2-enoyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59629928 |
| Molecular Formula | C40H40O9 |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | [4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-2-propylphenyl] 6-(2-methylprop-2-enoyloxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc4cc(OC(=O)C(=C)C)ccc4c3)c(CCC)c2)cc1 |
| InChI | InChI=1S/C40H40O9/c1-5-11-31-26-35(48-39(43)28-14-17-33(18-15-28)45-22-9-7-8-10-23-46-37(41)6-2)20-21-36(31)49-40(44)32-13-12-30-25-34(19-16-29(30)24-32)47-38(42)27(3)4/h6,12-21,24-26H,2-3,5,7-11,22-23H2,1,4H3 |
| InChIKey | IKNREBULESAIMN-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|