C26H24O4 — CID 22088303
[4-[(4-ethenylphenoxy)methoxy]-2,3-dimethylphenyl] 4-ethenylbenzoate (PubChem CID 22088303) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is [4-[(4-ethenylphenoxy)methoxy]-2,3-dimethylphenyl] 4-ethenylbenzoate.
| Compound Name | [4-[(4-ethenylphenoxy)methoxy]-2,3-dimethylphenyl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 22088303 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [4-[(4-ethenylphenoxy)methoxy]-2,3-dimethylphenyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(OCOc2ccc(OC(=O)c3ccc(C=C)cc3)c(C)c2C)cc1 |
| InChI | InChI=1S/C26H24O4/c1-5-20-7-11-22(12-8-20)26(27)30-25-16-15-24(18(3)19(25)4)29-17-28-23-13-9-21(6-2)10-14-23/h5-16H,1-2,17H2,3-4H3 |
| InChIKey | RUTJBBBGXWOQNW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|