C33H27F5O4 — CID 102125037
(2,3,4,5,6-pentafluorophenyl) 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate (PubChem CID 102125037) has the molecular formula C33H27F5O4 and a molecular weight of 582.56 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 102125037 |
| Molecular Formula | C33H27F5O4 |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate |
| SMILES | C=Cc1ccc(OCCCCCCOc2ccc(-c3ccc(C(=O)Oc4c(F)c(F)c(F)c(F)c4F)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H27F5O4/c1-2-21-7-15-25(16-8-21)40-19-5-3-4-6-20-41-26-17-13-23(14-18-26)22-9-11-24(12-10-22)33(39)42-32-30(37)28(35)27(34)29(36)31(32)38/h2,7-18H,1,3-6,19-20H2 |
| InChIKey | YFFZLXHMSORADT-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|