C29H29F3O4 — CID 102125036
2,2,2-trifluoroethyl 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate (PubChem CID 102125036) has the molecular formula C29H29F3O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate.
| Compound Name | 2,2,2-trifluoroethyl 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 102125036 |
| Molecular Formula | C29H29F3O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-[4-[6-(4-ethenylphenoxy)hexoxy]phenyl]benzoate |
| SMILES | C=Cc1ccc(OCCCCCCOc2ccc(-c3ccc(C(=O)OCC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H29F3O4/c1-2-22-7-15-26(16-8-22)34-19-5-3-4-6-20-35-27-17-13-24(14-18-27)23-9-11-25(12-10-23)28(33)36-21-29(30,31)32/h2,7-18H,1,3-6,19-21H2 |
| InChIKey | GHYZPKCWIGSSMM-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|