C20H20F4O3 — CID 21180058
2,2,3,3-tetrafluoropropyl 4-(4-butoxyphenyl)benzoate (PubChem CID 21180058) has the molecular formula C20H20F4O3 and a molecular weight of 384.37 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-(4-butoxyphenyl)benzoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-(4-butoxyphenyl)benzoate |
|---|---|
| PubChem CID | 21180058 |
| Molecular Formula | C20H20F4O3 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-(4-butoxyphenyl)benzoate |
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)OCC(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H20F4O3/c1-2-3-12-26-17-10-8-15(9-11-17)14-4-6-16(7-5-14)18(25)27-13-20(23,24)19(21)22/h4-11,19H,2-3,12-13H2,1H3 |
| InChIKey | HAJDZQZGLLBVBQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|