C37H36F8O5 — CID 100965845
[4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)phenyl] 4-[2-(4-decoxyphenyl)ethynyl]benzoate (PubChem CID 100965845) has the molecular formula C37H36F8O5 and a molecular weight of 712.67 g/mol. Its IUPAC name is [4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)phenyl] 4-[2-(4-decoxyphenyl)ethynyl]benzoate.
| Compound Name | [4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)phenyl] 4-[2-(4-decoxyphenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 100965845 |
| Molecular Formula | C37H36F8O5 |
| Molecular Weight | 712.67 g/mol |
| Exact Mass | 712.24 |
| IUPAC Name | [4-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)phenyl] 4-[2-(4-decoxyphenyl)ethynyl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(C#Cc2ccc(C(=O)Oc3ccc(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H36F8O5/c1-2-3-4-5-6-7-8-9-24-48-30-20-14-27(15-21-30)11-10-26-12-16-29(17-13-26)33(47)50-31-22-18-28(19-23-31)32(46)49-25-35(40,41)37(44,45)36(42,43)34(38)39/h12-23,34H,2-9,24-25H2,1H3 |
| InChIKey | HZLCZDDWNVAQCV-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.67 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|