C20H15F8NO4 — CID 58616841
4-O-[4-(methylamino)phenyl] 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) benzene-1,4-dicarboxylate (PubChem CID 58616841) has the molecular formula C20H15F8NO4 and a molecular weight of 485.33 g/mol. Its IUPAC name is 4-O-[4-(methylamino)phenyl] 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[4-(methylamino)phenyl] 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58616841 |
| Molecular Formula | C20H15F8NO4 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 4-O-[4-(methylamino)phenyl] 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) benzene-1,4-dicarboxylate |
| SMILES | CNc1ccc(OC(=O)c2ccc(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H15F8NO4/c1-29-13-6-8-14(9-7-13)33-16(31)12-4-2-11(3-5-12)15(30)32-10-18(23,24)20(27,28)19(25,26)17(21)22/h2-9,17,29H,10H2,1H3 |
| InChIKey | HFRILXDRXRHUSN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|