C20H15F16NO3 — CID 4108539
butyl 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)benzoate (PubChem CID 4108539) has the molecular formula C20H15F16NO3 and a molecular weight of 621.31 g/mol. Its IUPAC name is butyl 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)benzoate.
| Compound Name | butyl 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)benzoate |
|---|---|
| PubChem CID | 4108539 |
| Molecular Formula | C20H15F16NO3 |
| Molecular Weight | 621.31 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | butyl 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoylamino)benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C20H15F16NO3/c1-2-3-8-40-11(38)9-4-6-10(7-5-9)37-13(39)15(25,26)17(29,30)19(33,34)20(35,36)18(31,32)16(27,28)14(23,24)12(21)22/h4-7,12H,2-3,8H2,1H3,(H,37,39) |
| InChIKey | IDISMJSRDDIYMO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.31 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|