C21H11F16N3O — CID 5062321
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-phenyldiazenylphenyl)nonanamide (PubChem CID 5062321) has the molecular formula C21H11F16N3O and a molecular weight of 625.31 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-phenyldiazenylphenyl)nonanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-phenyldiazenylphenyl)nonanamide |
|---|---|
| PubChem CID | 5062321 |
| Molecular Formula | C21H11F16N3O |
| Molecular Weight | 625.31 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(4-phenyldiazenylphenyl)nonanamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H11F16N3O/c22-13(23)15(24,25)17(28,29)19(32,33)21(36,37)20(34,35)18(30,31)16(26,27)14(41)38-10-6-8-12(9-7-10)40-39-11-4-2-1-3-5-11/h1-9,13H,(H,38,41)/b40-39+ |
| InChIKey | PQPRYKADCSLOSS-XQQUEIPISA-N |
| XLogP | 8.75 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.31 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|