C24H24F8O3 — CID 19776078
2,2,3,3,4,4,5,5-octafluoropentyl 4-(4-hexoxyphenyl)benzoate (PubChem CID 19776078) has the molecular formula C24H24F8O3 and a molecular weight of 512.44 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 4-(4-hexoxyphenyl)benzoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 4-(4-hexoxyphenyl)benzoate |
|---|---|
| PubChem CID | 19776078 |
| Molecular Formula | C24H24F8O3 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 4-(4-hexoxyphenyl)benzoate |
| SMILES | CCCCCCOc1ccc(-c2ccc(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H24F8O3/c1-2-3-4-5-14-34-19-12-10-17(11-13-19)16-6-8-18(9-7-16)20(33)35-15-22(27,28)24(31,32)23(29,30)21(25)26/h6-13,21H,2-5,14-15H2,1H3 |
| InChIKey | MDNKBFGIPJJDHY-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|