C23H13F16NO3 — CID 58616836
[4-(methylamino)phenyl] 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)benzoate (PubChem CID 58616836) has the molecular formula C23H13F16NO3 and a molecular weight of 655.33 g/mol. Its IUPAC name is [4-(methylamino)phenyl] 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)benzoate.
| Compound Name | [4-(methylamino)phenyl] 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)benzoate |
|---|---|
| PubChem CID | 58616836 |
| Molecular Formula | C23H13F16NO3 |
| Molecular Weight | 655.33 g/mol |
| Exact Mass | 655.06 |
| IUPAC Name | [4-(methylamino)phenyl] 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)benzoate |
| SMILES | CNc1ccc(OC(=O)c2ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H13F16NO3/c1-40-12-6-8-13(9-7-12)43-15(42)11-4-2-10(3-5-11)14(41)17(26,27)19(30,31)21(34,35)23(38,39)22(36,37)20(32,33)18(28,29)16(24)25/h2-9,16,40H,1H3 |
| InChIKey | WQCJXTVTJRTMSR-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.33 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|