C18H13F6NO3 — CID 58616826
[4-(methylamino)phenyl] 4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]benzoate (PubChem CID 58616826) has the molecular formula C18H13F6NO3 and a molecular weight of 405.29 g/mol. Its IUPAC name is [4-(methylamino)phenyl] 4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]benzoate.
| Compound Name | [4-(methylamino)phenyl] 4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]benzoate |
|---|---|
| PubChem CID | 58616826 |
| Molecular Formula | C18H13F6NO3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [4-(methylamino)phenyl] 4-[3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]benzoate |
| SMILES | CNc1ccc(OC(=O)c2ccc(C(=O)C(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H13F6NO3/c1-25-12-6-8-13(9-7-12)28-16(27)11-4-2-10(3-5-11)14(26)15(17(19,20)21)18(22,23)24/h2-9,15,25H,1H3 |
| InChIKey | RBDGLROWERBLAD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|