C20H10F12O — CID 89084264
1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one (PubChem CID 89084264) has the molecular formula C20H10F12O and a molecular weight of 494.28 g/mol. Its IUPAC name is 1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one.
| Compound Name | 1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one |
|---|---|
| PubChem CID | 89084264 |
| Molecular Formula | C20H10F12O |
| Molecular Weight | 494.28 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one |
| SMILES | O=C(c1ccc2c(c1)Cc1ccccc1-2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H10F12O/c21-15(22)17(25,26)19(29,30)20(31,32)18(27,28)16(23,24)14(33)10-5-6-13-11(8-10)7-9-3-1-2-4-12(9)13/h1-6,8,15H,7H2 |
| InChIKey | WURFURFFDYRQBF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.28 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|