C15H9BrF8O4 — CID 91742080
4-O-(4-bromophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate (PubChem CID 91742080) has the molecular formula C15H9BrF8O4 and a molecular weight of 485.12 g/mol. Its IUPAC name is 4-O-(4-bromophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(4-bromophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91742080 |
| Molecular Formula | C15H9BrF8O4 |
| Molecular Weight | 485.12 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | 4-O-(4-bromophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)Oc1ccc(Br)cc1)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H9BrF8O4/c16-8-1-3-9(4-2-8)28-11(26)6-5-10(25)27-7-13(19,20)15(23,24)14(21,22)12(17)18/h1-6,12H,7H2/b6-5+ |
| InChIKey | AZFUITGMYJGTHK-AATRIKPKSA-N |
| XLogP | 4.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.12 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|