C10H4F16O2 — CID 134871742
2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3,4,4,5,5-octafluoropentanoate (PubChem CID 134871742) has the molecular formula C10H4F16O2 and a molecular weight of 460.11 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3,4,4,5,5-octafluoropentanoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3,4,4,5,5-octafluoropentanoate |
|---|---|
| PubChem CID | 134871742 |
| Molecular Formula | C10H4F16O2 |
| Molecular Weight | 460.11 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2,2,3,3,4,4,5,5-octafluoropentanoate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H4F16O2/c11-2(12)6(17,18)9(23,24)5(15,16)1-28-4(27)8(21,22)10(25,26)7(19,20)3(13)14/h2-3H,1H2 |
| InChIKey | ASGPRBBUWSNFMT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.11 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|